C27H55N3O6Si3 — CID 169066976
1-[(2R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 169066976) has the molecular formula C27H55N3O6Si3 and a molecular weight of 602.01 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 169066976 |
| Molecular Formula | C27H55N3O6Si3 |
| Molecular Weight | 602.01 g/mol |
| Exact Mass | 601.34 |
| IUPAC Name | 1-[(2R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H55N3O6Si3/c1-25(2,3)37(10,11)33-18-19-21(35-38(12,13)26(4,5)6)22(36-39(14,15)27(7,8)9)23(34-19)30-17-16-20(29-32)28-24(30)31/h16-17,19,21-23,32H,18H2,1-15H3,(H,28,29,31)/t19-,21+,22?,23-/m1/s1 |
| InChIKey | VKPKQNLIKHNXLI-SPVLSBBKSA-N |
| XLogP | 6.74 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.01 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|