C40H62N2O5SSi3 — CID 18394978
1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one (PubChem CID 18394978) has the molecular formula C40H62N2O5SSi3 and a molecular weight of 767.27 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 18394978 |
| Molecular Formula | C40H62N2O5SSi3 |
| Molecular Weight | 767.27 g/mol |
| Exact Mass | 766.37 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-(9H-fluoren-9-yl)-4-sulfanylidenepyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cc(C3c4ccccc4-c4ccccc43)c(=S)[nH]c2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H62N2O5SSi3/c1-38(2,3)49(10,11)44-25-31-33(46-50(12,13)39(4,5)6)34(47-51(14,15)40(7,8)9)36(45-31)42-24-30(35(48)41-37(42)43)32-28-22-18-16-20-26(28)27-21-17-19-23-29(27)32/h16-24,31-34,36H,25H2,1-15H3,(H,41,43,48)/t31-,33-,34-,36-/m1/s1 |
| InChIKey | ZLEABXOQRQYXKS-YDXJMRNDSA-N |
| XLogP | 10.77 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.27 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|