C30H58N2O6Si3 — CID 67566728
1-[(2S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione (PubChem CID 67566728) has the molecular formula C30H58N2O6Si3 and a molecular weight of 627.06 g/mol. Its IUPAC name is 1-[(2S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67566728 |
| Molecular Formula | C30H58N2O6Si3 |
| Molecular Weight | 627.06 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | 1-[(2S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCc1cn([C@H]2O[C@@H](CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H58N2O6Si3/c1-17-18-21-19-32(27(34)31-25(21)33)26-24(38-41(15,16)30(8,9)10)23(37-40(13,14)29(5,6)7)22(36-26)20-35-39(11,12)28(2,3)4/h17,19,22-24,26H,1,18,20H2,2-16H3,(H,31,33,34)/t22-,23?,24?,26-/m0/s1 |
| InChIKey | BYRUJKLJKROYLS-IDABCOFVSA-N |
| XLogP | 6.97 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.06 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|