C28H55N5O6Si3 — CID 135488127
2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,7-dihydropurine-6,8-dione (PubChem CID 135488127) has the molecular formula C28H55N5O6Si3 and a molecular weight of 642.04 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,7-dihydropurine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 135488127 |
| Molecular Formula | C28H55N5O6Si3 |
| Molecular Weight | 642.04 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,7-dihydropurine-6,8-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2c(=O)[nH]c3c(=O)[nH]c(N)nc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H55N5O6Si3/c1-26(2,3)40(10,11)36-16-17-19(38-41(12,13)27(4,5)6)20(39-42(14,15)28(7,8)9)23(37-17)33-21-18(30-25(33)35)22(34)32-24(29)31-21/h17,19-20,23H,16H2,1-15H3,(H,30,35)(H3,29,31,32,34)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | CYWJVOCXRVZXGB-ZDXOVATRSA-N |
| XLogP | 5.70 |
| TPSA | 146.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.04 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|