C20H30N4O8SSi — CID 136593115
[(2R,3R,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 136593115) has the molecular formula C20H30N4O8SSi and a molecular weight of 514.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 136593115 |
| Molecular Formula | C20H30N4O8SSi |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]1n1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C20H30N4O8SSi/c1-9(25)30-12-11(8-29-34(6,7)20(3,4)5)32-17(13(12)31-10(2)26)24-15-14(33-19(24)28)16(27)23-18(21)22-15/h11-13,17H,8H2,1-7H3,(H3,21,22,23,27)/t11-,12-,13-,17-/m1/s1 |
| InChIKey | YGDYAVPGMUYNIS-HPTBWKMGSA-N |
| XLogP | 1.51 |
| TPSA | 164.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|