C17H20N4O8S — CID 59346356
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate (PubChem CID 59346356) has the molecular formula C17H20N4O8S and a molecular weight of 440.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59346356 |
| Molecular Formula | C17H20N4O8S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(=O)sc3c(C)nc(N)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H20N4O8S/c1-6-13-14(20-16(18)19-6)21(17(25)30-13)15-12(28-9(4)24)11(27-8(3)23)10(29-15)5-26-7(2)22/h10-12,15H,5H2,1-4H3,(H2,18,19,20)/t10-,11-,12-,15-/m1/s1 |
| InChIKey | OZDGMMYBMPLNOZ-RTWAVKEYSA-N |
| XLogP | 0.07 |
| TPSA | 161.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|