C22H32N4O7S — CID 11612968
[(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-octoxyoxolan-2-yl]methyl acetate (PubChem CID 11612968) has the molecular formula C22H32N4O7S and a molecular weight of 496.59 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-octoxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-octoxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11612968 |
| Molecular Formula | C22H32N4O7S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-octoxyoxolan-2-yl]methyl acetate |
| SMILES | CCCCCCCCO[C@@H]1[C@@H](OC(C)=O)[C@H](n2c(=O)sc3cnc(N)nc32)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C22H32N4O7S/c1-4-5-6-7-8-9-10-30-17-15(12-31-13(2)27)33-20(18(17)32-14(3)28)26-19-16(34-22(26)29)11-24-21(23)25-19/h11,15,17-18,20H,4-10,12H2,1-3H3,(H2,23,24,25)/t15-,17+,18-,20-/m1/s1 |
| InChIKey | ZBUCCXAHCNGSIV-MJKGWSOKSA-N |
| XLogP | 2.57 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|