C19H26N2O9 — CID 10928045
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-butoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 10928045) has the molecular formula C19H26N2O9 and a molecular weight of 426.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-butoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-butoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10928045 |
| Molecular Formula | C19H26N2O9 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-butoxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CCCCOc1ccn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)c(=O)n1 |
| InChI | InChI=1S/C19H26N2O9/c1-5-6-9-26-15-7-8-21(19(25)20-15)18-17(29-13(4)24)16(28-12(3)23)14(30-18)10-27-11(2)22/h7-8,14,16-18H,5-6,9-10H2,1-4H3/t14-,16-,17-,18-/m1/s1 |
| InChIKey | FKAMVPRVYJXUDU-VDHUWJSZSA-N |
| XLogP | 0.75 |
| TPSA | 132.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|