C19H21Cl3N2O11 — CID 131884624
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-methoxy-2-oxopyrimidin-1-yl)oxan-3-yl] 2,2,2-trichloroacetate (PubChem CID 131884624) has the molecular formula C19H21Cl3N2O11 and a molecular weight of 559.74 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-methoxy-2-oxopyrimidin-1-yl)oxan-3-yl] 2,2,2-trichloroacetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-methoxy-2-oxopyrimidin-1-yl)oxan-3-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 131884624 |
| Molecular Formula | C19H21Cl3N2O11 |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-2-(4-methoxy-2-oxopyrimidin-1-yl)oxan-3-yl] 2,2,2-trichloroacetate |
| SMILES | COc1ccn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(=O)C(Cl)(Cl)Cl)c(=O)n1 |
| InChI | InChI=1S/C19H21Cl3N2O11/c1-8(25)31-7-11-13(32-9(2)26)14(33-10(3)27)15(35-17(28)19(20,21)22)16(34-11)24-6-5-12(30-4)23-18(24)29/h5-6,11,13-16H,7H2,1-4H3/t11-,13-,14+,15-,16-/m1/s1 |
| InChIKey | MTIWBQFIDDJRSO-YMILTQATSA-N |
| XLogP | 0.86 |
| TPSA | 158.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|