C24H25NO11 — CID 25193345
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(1,5-dioxo-2-benzazepin-2-yl)oxan-2-yl]methyl acetate (PubChem CID 25193345) has the molecular formula C24H25NO11 and a molecular weight of 503.46 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(1,5-dioxo-2-benzazepin-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(1,5-dioxo-2-benzazepin-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 25193345 |
| Molecular Formula | C24H25NO11 |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(1,5-dioxo-2-benzazepin-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ccc(=O)c3ccccc3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H25NO11/c1-12(26)32-11-19-20(33-13(2)27)21(34-14(3)28)22(35-15(4)29)24(36-19)25-10-9-18(30)16-7-5-6-8-17(16)23(25)31/h5-10,19-22,24H,11H2,1-4H3/t19-,20+,21+,22-,24-/m1/s1 |
| InChIKey | KICAOBUJFGULEO-KQWJERSKSA-N |
| XLogP | 0.62 |
| TPSA | 153.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|