C25H29NO11 — CID 77394145
methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indol-3-yl]acetate (PubChem CID 77394145) has the molecular formula C25H29NO11 and a molecular weight of 519.50 g/mol. Its IUPAC name is methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indol-3-yl]acetate.
| Compound Name | methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 77394145 |
| Molecular Formula | C25H29NO11 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indol-3-yl]acetate |
| SMILES | COC(=O)Cc1cn(C2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C25H29NO11/c1-13(27)33-12-20-22(34-14(2)28)23(35-15(3)29)24(36-16(4)30)25(37-20)26-11-17(10-21(31)32-5)18-8-6-7-9-19(18)26/h6-9,11,20,22-25H,10,12H2,1-5H3 |
| InChIKey | PSRKDFMNBSXDOW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 145.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|