C28H27ClINO9 — CID 141147468
[(2R,3R,4S,5R)-6-[3-(2-chloro-4-iodophenyl)indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 141147468) has the molecular formula C28H27ClINO9 and a molecular weight of 687.90 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-[3-(2-chloro-4-iodophenyl)indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-6-[3-(2-chloro-4-iodophenyl)indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141147468 |
| Molecular Formula | C28H27ClINO9 |
| Molecular Weight | 687.90 g/mol |
| Exact Mass | 687.07 |
| IUPAC Name | [(2R,3R,4S,5R)-6-[3-(2-chloro-4-iodophenyl)indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2cc(-c3ccc(I)cc3Cl)c3ccccc32)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C28H27ClINO9/c1-14(32)36-13-24-25(37-15(2)33)26(38-16(3)34)27(39-17(4)35)28(40-24)31-12-21(20-7-5-6-8-23(20)31)19-10-9-18(30)11-22(19)29/h5-12,24-28H,13H2,1-4H3/t24-,25-,26+,27-,28?/m1/s1/i1D,2D,3D,4D |
| InChIKey | COHGJPHRBULNBR-OFERWNNOSA-N |
| XLogP | 4.82 |
| TPSA | 119.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|