C41H38N4O12 — CID 11147107
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2,5-dioxo-1-(phenylmethoxymethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrol-3-yl]indol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 11147107) has the molecular formula C41H38N4O12 and a molecular weight of 778.77 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2,5-dioxo-1-(phenylmethoxymethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrol-3-yl]indol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2,5-dioxo-1-(phenylmethoxymethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrol-3-yl]indol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11147107 |
| Molecular Formula | C41H38N4O12 |
| Molecular Weight | 778.77 g/mol |
| Exact Mass | 778.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2,5-dioxo-1-(phenylmethoxymethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrol-3-yl]indol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C3=C(c4c[nH]c5ncccc45)C(=O)N(COCc4ccccc4)C3=O)c3ccccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C41H38N4O12/c1-22(46)53-20-32-35(54-23(2)47)36(55-24(3)48)37(56-25(4)49)41(57-32)44-18-30(27-13-8-9-15-31(27)44)34-33(29-17-43-38-28(29)14-10-16-42-38)39(50)45(40(34)51)21-52-19-26-11-6-5-7-12-26/h5-18,32,35-37,41H,19-21H2,1-4H3,(H,42,43)/t32-,35-,36+,37-,41-/m1/s1 |
| InChIKey | YFHNLFOYWAOLLV-CMAPAOHXSA-N |
| XLogP | 4.23 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.77 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|