C22H27NO7 — CID 71086492
[(5R)-4,5-diacetyloxy-3-methyl-6-(3-methylindol-1-yl)oxan-2-yl]methyl acetate (PubChem CID 71086492) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is [(5R)-4,5-diacetyloxy-3-methyl-6-(3-methylindol-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(5R)-4,5-diacetyloxy-3-methyl-6-(3-methylindol-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71086492 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [(5R)-4,5-diacetyloxy-3-methyl-6-(3-methylindol-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cc(C)c3ccccc32)[C@H](OC(C)=O)C(OC(C)=O)C1C |
| InChI | InChI=1S/C22H27NO7/c1-12-10-23(18-9-7-6-8-17(12)18)22-21(29-16(5)26)20(28-15(4)25)13(2)19(30-22)11-27-14(3)24/h6-10,13,19-22H,11H2,1-5H3/t13?,19?,20?,21-,22?/m1/s1 |
| InChIKey | ZCEKZBGBWKITSI-FHWSVKTASA-N |
| XLogP | 2.91 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|