C19H23ClO7 — CID 158628876
[(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-chlorophenyl)-3-methyloxan-2-yl]methyl acetate (PubChem CID 158628876) has the molecular formula C19H23ClO7 and a molecular weight of 398.84 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-chlorophenyl)-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-chlorophenyl)-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 158628876 |
| Molecular Formula | C19H23ClO7 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-chlorophenyl)-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C19H23ClO7/c1-10-16(9-24-11(2)21)27-18(14-5-7-15(20)8-6-14)19(26-13(4)23)17(10)25-12(3)22/h5-8,10,16-19H,9H2,1-4H3/t10-,16-,17+,18+,19-/m1/s1 |
| InChIKey | PWRLTFWYNMFLHR-KSPBXPDDSA-N |
| XLogP | 2.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|