C20H24O5 — CID 90365485
[(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-ethynylphenyl)-3-methyloxan-4-yl] acetate (PubChem CID 90365485) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-ethynylphenyl)-3-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-ethynylphenyl)-3-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 90365485 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-ethynylphenyl)-3-methyloxan-4-yl] acetate |
| SMILES | C#Cc1ccc([C@H]2O[C@H](CC)[C@@H](C)[C@H](OC(C)=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C20H24O5/c1-6-15-8-10-16(11-9-15)19-20(24-14(5)22)18(23-13(4)21)12(3)17(7-2)25-19/h1,8-12,17-20H,7H2,2-5H3/t12-,17-,18+,19-,20+/m1/s1 |
| InChIKey | SRPFEXNHAGHVGW-NMDLUNGESA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|