C20H22O8 — CID 134570358
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(4-ethynylphenyl)-3-hydroxyoxan-2-yl]methyl acetate (PubChem CID 134570358) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(4-ethynylphenyl)-3-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(4-ethynylphenyl)-3-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134570358 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(4-ethynylphenyl)-3-hydroxyoxan-2-yl]methyl acetate |
| SMILES | C#Cc1ccc([C@H]2O[C@H](COC(C)=O)[C@@H](O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C20H22O8/c1-5-14-6-8-15(9-7-14)18-20(27-13(4)23)19(26-12(3)22)17(24)16(28-18)10-25-11(2)21/h1,6-9,16-20,24H,10H2,2-4H3/t16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | DBVGHVSATGWIJE-LTFPLMDUSA-N |
| XLogP | 0.90 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|