C16H19BO7 — CID 89271962
CID 89271962 (PubChem CID 89271962) has the molecular formula C16H19BO7 and a molecular weight of 334.13 g/mol.
| Compound Name | CID 89271962 |
|---|---|
| PubChem CID | 89271962 |
| Molecular Formula | C16H19BO7 |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc([C@@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(O)C2O)cc1 |
| InChI | InChI=1S/C16H19BO7/c1-8(18)22-7-12-16(23-9(2)19)14(21)13(20)15(24-12)10-3-5-11(17)6-4-10/h3-6,12-16,20-21H,7H2,1-2H3/t12?,13?,14?,15-,16+/m0/s1 |
| InChIKey | GOFATNYYGIZICQ-AVYBUENTSA-N |
| XLogP | -0.86 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|