C22H25NO8 — CID 123306702
[4,5-diacetyloxy-6-(3-formylindol-1-yl)-3-methyloxan-2-yl]methyl acetate (PubChem CID 123306702) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-(3-formylindol-1-yl)-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-6-(3-formylindol-1-yl)-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123306702 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | [4,5-diacetyloxy-6-(3-formylindol-1-yl)-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cc(C=O)c3ccccc32)C(OC(C)=O)C(OC(C)=O)C1C |
| InChI | InChI=1S/C22H25NO8/c1-12-19(11-28-13(2)25)31-22(21(30-15(4)27)20(12)29-14(3)26)23-9-16(10-24)17-7-5-6-8-18(17)23/h5-10,12,19-22H,11H2,1-4H3 |
| InChIKey | YISCEFLAUJYAPH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|