C23H25NO11 — CID 11283251
1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carboxylic acid (PubChem CID 11283251) has the molecular formula C23H25NO11 and a molecular weight of 491.45 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carboxylic acid.
| Compound Name | 1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 11283251 |
| Molecular Formula | C23H25NO11 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carboxylic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C(=O)O)c3ccccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H25NO11/c1-11(25)31-10-18-19(32-12(2)26)20(33-13(3)27)21(34-14(4)28)22(35-18)24-9-16(23(29)30)15-7-5-6-8-17(15)24/h5-9,18-22H,10H2,1-4H3,(H,29,30)/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | DJKXBQFFAVPYFO-QMCAAQAGSA-N |
| XLogP | 1.60 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|