C23H29NO9 — CID 595511
[3,4,5-triacetyloxy-6-(3,4-dihydro-2H-quinolin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 595511) has the molecular formula C23H29NO9 and a molecular weight of 463.48 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(3,4-dihydro-2H-quinolin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(3,4-dihydro-2H-quinolin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 595511 |
| Molecular Formula | C23H29NO9 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(3,4-dihydro-2H-quinolin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(N2CCCc3ccccc32)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H29NO9/c1-13(25)29-12-19-20(30-14(2)26)21(31-15(3)27)22(32-16(4)28)23(33-19)24-11-7-9-17-8-5-6-10-18(17)24/h5-6,8,10,19-23H,7,9,11-12H2,1-4H3 |
| InChIKey | JIOXVEQZAZJKPU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|