C24H29NO9S3 — CID 154708146
[(3R,6S)-3,4,5-triacetyloxy-6-(3,4-dihydro-1H-isoquinoline-2-carbothioyldisulfanyl)oxan-2-yl]methyl acetate (PubChem CID 154708146) has the molecular formula C24H29NO9S3 and a molecular weight of 571.70 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-(3,4-dihydro-1H-isoquinoline-2-carbothioyldisulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-(3,4-dihydro-1H-isoquinoline-2-carbothioyldisulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154708146 |
| Molecular Formula | C24H29NO9S3 |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-(3,4-dihydro-1H-isoquinoline-2-carbothioyldisulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](SSC(=S)N2CCc3ccccc3C2)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H29NO9S3/c1-13(26)30-12-19-20(31-14(2)27)21(32-15(3)28)22(33-16(4)29)23(34-19)36-37-24(35)25-10-9-17-7-5-6-8-18(17)11-25/h5-8,19-23H,9-12H2,1-4H3/t19?,20-,21?,22?,23+/m1/s1 |
| InChIKey | PSKXATWRXMOKDZ-BKBARPBUSA-N |
| XLogP | 2.79 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|