C27H28O10S — CID 170563180
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(9H-xanthen-9-ylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 170563180) has the molecular formula C27H28O10S and a molecular weight of 544.58 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(9H-xanthen-9-ylsulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(9H-xanthen-9-ylsulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170563180 |
| Molecular Formula | C27H28O10S |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(9H-xanthen-9-ylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](SC2c3ccccc3Oc3ccccc32)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H28O10S/c1-14(28)32-13-22-23(33-15(2)29)24(34-16(3)30)25(35-17(4)31)27(37-22)38-26-18-9-5-7-11-20(18)36-21-12-8-6-10-19(21)26/h5-12,22-27H,13H2,1-4H3/t22-,23-,24+,25+,27-/m1/s1 |
| InChIKey | NKDHMLSSQSHFOU-PUMXGNEJSA-N |
| XLogP | 3.70 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|