C17H25NO9S2 — CID 124865291
[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(dimethylcarbamothioylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 124865291) has the molecular formula C17H25NO9S2 and a molecular weight of 451.52 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(dimethylcarbamothioylsulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(dimethylcarbamothioylsulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124865291 |
| Molecular Formula | C17H25NO9S2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(dimethylcarbamothioylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](SC(=S)N(C)C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H25NO9S2/c1-8(19)23-7-12-13(24-9(2)20)14(25-10(3)21)15(26-11(4)22)16(27-12)29-17(28)18(5)6/h12-16H,7H2,1-6H3/t12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | FBQYBXQYUKZNKC-UYJHQMFVSA-N |
| XLogP | 0.65 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|