C17H26N2O11S — CID 134936338
[amino-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylidene]azanium acetate (PubChem CID 134936338) has the molecular formula C17H26N2O11S and a molecular weight of 466.47 g/mol. Its IUPAC name is [amino-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylidene]azanium acetate.
| Compound Name | [amino-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylidene]azanium acetate |
|---|---|
| PubChem CID | 134936338 |
| Molecular Formula | C17H26N2O11S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [amino-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylmethylidene]azanium acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SC(N)=[NH2+])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.CC(=O)[O-] |
| InChI | InChI=1S/C15H22N2O9S.C2H4O2/c1-6(18)22-5-10-11(23-7(2)19)12(24-8(3)20)13(25-9(4)21)14(26-10)27-15(16)17;1-2(3)4/h10-14H,5H2,1-4H3,(H3,16,17);1H3,(H,3,4)/t10-,11-,12+,13-,14+;/m1./s1 |
| InChIKey | BLHOJODGWJXZQR-SXQUUHMTSA-N |
| XLogP | -3.37 |
| TPSA | 206.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|