C15H24ClN3O8S — CID 68914573
[[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-aminomethylidene]azanium chloride (PubChem CID 68914573) has the molecular formula C15H24ClN3O8S and a molecular weight of 441.89 g/mol. Its IUPAC name is [[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-aminomethylidene]azanium chloride.
| Compound Name | [[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-aminomethylidene]azanium chloride |
|---|---|
| PubChem CID | 68914573 |
| Molecular Formula | C15H24ClN3O8S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [[(2S,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-aminomethylidene]azanium chloride |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1SC(N)=[NH2+].[Cl-] |
| InChI | InChI=1S/C15H23N3O8S.ClH/c1-6(19)18-11-13(25-9(4)22)12(24-8(3)21)10(5-23-7(2)20)26-14(11)27-15(16)17;/h10-14H,5H2,1-4H3,(H3,16,17)(H,18,19);1H/t10-,11-,12-,13-,14+;/m1./s1 |
| InChIKey | IFWPNCIZOWSMBN-XHNNQSHGSA-N |
| XLogP | -5.55 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | -5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|