C24H28N2O9 — CID 139156671
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzyl-2H-imidazol-3-ium-2-id-1-yl)oxan-2-yl]methyl acetate (PubChem CID 139156671) has the molecular formula C24H28N2O9 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzyl-2H-imidazol-3-ium-2-id-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzyl-2H-imidazol-3-ium-2-id-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139156671 |
| Molecular Formula | C24H28N2O9 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzyl-2H-imidazol-3-ium-2-id-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2[c-][n+](Cc3ccccc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H28N2O9/c1-15(27)31-13-20-21(32-16(2)28)22(33-17(3)29)23(34-18(4)30)24(35-20)26-11-10-25(14-26)12-19-8-6-5-7-9-19/h5-11,20-24H,12-13H2,1-4H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | KTVOCKWDSYHSSG-GNADVCDUSA-N |
| XLogP | 0.88 |
| TPSA | 123.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|