C29H27Cl2NO10 — CID 67198660
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-chlorobenzoyl)indol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 67198660) has the molecular formula C29H27Cl2NO10 and a molecular weight of 620.44 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-chlorobenzoyl)indol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-chlorobenzoyl)indol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67198660 |
| Molecular Formula | C29H27Cl2NO10 |
| Molecular Weight | 620.44 g/mol |
| Exact Mass | 619.10 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-chlorobenzoyl)indol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C(=O)c3ccc(Cl)cc3)c3c(Cl)cccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H27Cl2NO10/c1-14(33)38-13-23-26(39-15(2)34)27(40-16(3)35)28(41-17(4)36)29(42-23)32-12-20(24-21(31)6-5-7-22(24)32)25(37)18-8-10-19(30)11-9-18/h5-12,23,26-29H,13H2,1-4H3/t23-,26-,27+,28-,29-/m1/s1 |
| InChIKey | PRKXNXJUTFJWHG-ZKRUMVIUSA-N |
| XLogP | 4.43 |
| TPSA | 136.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|