C26H25ClN2O10 — CID 10698122
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(4-chlorophenyl)-3-cyano-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate (PubChem CID 10698122) has the molecular formula C26H25ClN2O10 and a molecular weight of 560.94 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(4-chlorophenyl)-3-cyano-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(4-chlorophenyl)-3-cyano-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10698122 |
| Molecular Formula | C26H25ClN2O10 |
| Molecular Weight | 560.94 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(4-chlorophenyl)-3-cyano-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(-c3ccc(Cl)cc3)ccc(C#N)c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H25ClN2O10/c1-13(30)35-12-21-22(36-14(2)31)23(37-15(3)32)24(38-16(4)33)26(39-21)29-20(10-7-18(11-28)25(29)34)17-5-8-19(27)9-6-17/h5-10,21-24,26H,12H2,1-4H3/t21-,22-,23+,24-,26-/m1/s1 |
| InChIKey | FWKZIZPQAPFKMG-HROMDODWSA-N |
| XLogP | 2.30 |
| TPSA | 160.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.94 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|