C18H20N2O8 — CID 11014678
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-cyano-6-methyl-2-oxo-1-pyridinyl)oxolan-2-yl]methyl acetate (PubChem CID 11014678) has the molecular formula C18H20N2O8 and a molecular weight of 392.36 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-cyano-6-methyl-2-oxo-1-pyridinyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-cyano-6-methyl-2-oxo-1-pyridinyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11014678 |
| Molecular Formula | C18H20N2O8 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-cyano-6-methyl-2-oxo-1-pyridinyl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(C)ccc(C#N)c2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H20N2O8/c1-9-5-6-13(7-19)17(24)20(9)18-16(27-12(4)23)15(26-11(3)22)14(28-18)8-25-10(2)21/h5-6,14-16,18H,8H2,1-4H3/t14-,15-,16-,18-/m1/s1 |
| InChIKey | YYHNCISYHIVMKD-YFHUEUNASA-N |
| XLogP | 0.35 |
| TPSA | 133.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|