C20H26N2O10S — CID 10600975
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 10600975) has the molecular formula C20H26N2O10S and a molecular weight of 486.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10600975 |
| Molecular Formula | C20H26N2O10S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CSc1nc(C)cc(=O)n1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H26N2O10S/c1-9-7-15(27)22(20(21-9)33-6)19-18(31-13(5)26)17(30-12(4)25)16(29-11(3)24)14(32-19)8-28-10(2)23/h7,14,16-19H,8H2,1-6H3/t14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | WFLALMZWSCSJMU-IQZDNPOKSA-N |
| XLogP | 0.53 |
| TPSA | 149.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|