C16H19NO10 — CID 23267368
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methyl-2,4-dioxo-1,3-oxazin-3-yl)oxolan-2-yl]methyl acetate (PubChem CID 23267368) has the molecular formula C16H19NO10 and a molecular weight of 385.33 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methyl-2,4-dioxo-1,3-oxazin-3-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methyl-2,4-dioxo-1,3-oxazin-3-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23267368 |
| Molecular Formula | C16H19NO10 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-methyl-2,4-dioxo-1,3-oxazin-3-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(=O)cc(C)oc2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H19NO10/c1-7-5-12(21)17(16(22)24-7)15-14(26-10(4)20)13(25-9(3)19)11(27-15)6-23-8(2)18/h5,11,13-15H,6H2,1-4H3/t11-,13-,14-,15-/m1/s1 |
| InChIKey | LEYXQVORPMHVRR-NMFUWQPSSA-N |
| XLogP | -0.57 |
| TPSA | 140.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|