C22H31N3O11 — CID 101083860
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(diethylamino)-2,4-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate (PubChem CID 101083860) has the molecular formula C22H31N3O11 and a molecular weight of 513.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(diethylamino)-2,4-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(diethylamino)-2,4-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101083860 |
| Molecular Formula | C22H31N3O11 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[6-(diethylamino)-2,4-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CCN(CC)c1cc(=O)[nH]c(=O)n1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H31N3O11/c1-7-24(8-2)17-9-16(30)23-22(31)25(17)21-20(35-14(6)29)19(34-13(5)28)18(33-12(4)27)15(36-21)10-32-11(3)26/h9,15,18-21H,7-8,10H2,1-6H3,(H,23,30,31)/t15-,18-,19+,20-,21-/m1/s1 |
| InChIKey | CIZVKWFFPLMLAG-CMWLGVBASA-N |
| XLogP | -0.36 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|