C23H31N3O11 — CID 101083864
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,4-dioxo-6-piperidin-1-ylpyrimidin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 101083864) has the molecular formula C23H31N3O11 and a molecular weight of 525.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,4-dioxo-6-piperidin-1-ylpyrimidin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,4-dioxo-6-piperidin-1-ylpyrimidin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101083864 |
| Molecular Formula | C23H31N3O11 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,4-dioxo-6-piperidin-1-ylpyrimidin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(N3CCCCC3)cc(=O)[nH]c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H31N3O11/c1-12(27)33-11-16-19(34-13(2)28)20(35-14(3)29)21(36-15(4)30)22(37-16)26-18(10-17(31)24-23(26)32)25-8-6-5-7-9-25/h10,16,19-22H,5-9,11H2,1-4H3,(H,24,31,32)/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | FSWQBBJLJGOZFU-RECXWPGBSA-N |
| XLogP | -0.22 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|