C20H22N4O11 — CID 23423402
[3,4,5-triacetyloxy-6-(2,4-dioxopteridin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 23423402) has the molecular formula C20H22N4O11 and a molecular weight of 494.41 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(2,4-dioxopteridin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(2,4-dioxopteridin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23423402 |
| Molecular Formula | C20H22N4O11 |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(2,4-dioxopteridin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2c(=O)[nH]c(=O)c3nccnc32)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H22N4O11/c1-8(25)31-7-12-14(32-9(2)26)15(33-10(3)27)16(34-11(4)28)19(35-12)24-17-13(21-5-6-22-17)18(29)23-20(24)30/h5-6,12,14-16,19H,7H2,1-4H3,(H,23,29,30) |
| InChIKey | YFHIJAZBPJARLJ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 195.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|