C17H18F3N5O8 — CID 137003177
[(2R,4S,5R)-3,4-diacetyloxy-5-[2-amino-6-oxo-8-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 137003177) has the molecular formula C17H18F3N5O8 and a molecular weight of 477.35 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-diacetyloxy-5-[2-amino-6-oxo-8-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,4S,5R)-3,4-diacetyloxy-5-[2-amino-6-oxo-8-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 137003177 |
| Molecular Formula | C17H18F3N5O8 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [(2R,4S,5R)-3,4-diacetyloxy-5-[2-amino-6-oxo-8-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(C(F)(F)F)nc3c(=O)[nH]c(N)nc32)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H18F3N5O8/c1-5(26)30-4-8-10(31-6(2)27)11(32-7(3)28)14(33-8)25-12-9(13(29)24-16(21)23-12)22-15(25)17(18,19)20/h8,10-11,14H,4H2,1-3H3,(H3,21,23,24,29)/t8-,10?,11+,14-/m1/s1 |
| InChIKey | PDMXETXGBOKQKF-PODXTCKDSA-N |
| XLogP | 0.04 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|