C21H27N5O11 — CID 14332362
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(8-amino-2-methoxy-1-methyl-6-oxopurin-9-yl)oxan-2-yl]methyl acetate (PubChem CID 14332362) has the molecular formula C21H27N5O11 and a molecular weight of 525.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(8-amino-2-methoxy-1-methyl-6-oxopurin-9-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(8-amino-2-methoxy-1-methyl-6-oxopurin-9-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14332362 |
| Molecular Formula | C21H27N5O11 |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(8-amino-2-methoxy-1-methyl-6-oxopurin-9-yl)oxan-2-yl]methyl acetate |
| SMILES | COc1nc2c(nc(N)n2[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(=O)n1C |
| InChI | InChI=1S/C21H27N5O11/c1-8(27)33-7-12-14(34-9(2)28)15(35-10(3)29)16(36-11(4)30)19(37-12)26-17-13(23-20(26)22)18(31)25(5)21(24-17)32-6/h12,14-16,19H,7H2,1-6H3,(H2,22,23)/t12-,14-,15+,16-,19-/m1/s1 |
| InChIKey | CQSYYSJVRYTCKU-IIRRGFMQSA-N |
| XLogP | -1.02 |
| TPSA | 202.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|