C23H24N6O8 — CID 137104215
[(2R,4S,5R)-3,4-diacetyloxy-5-(2-methyl-6-oxo-8-phenyldiazenyl-1H-purin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 137104215) has the molecular formula C23H24N6O8 and a molecular weight of 512.48 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-diacetyloxy-5-(2-methyl-6-oxo-8-phenyldiazenyl-1H-purin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,4S,5R)-3,4-diacetyloxy-5-(2-methyl-6-oxo-8-phenyldiazenyl-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 137104215 |
| Molecular Formula | C23H24N6O8 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | [(2R,4S,5R)-3,4-diacetyloxy-5-(2-methyl-6-oxo-8-phenyldiazenyl-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(/N=N/c3ccccc3)nc3c(=O)[nH]c(C)nc32)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H24N6O8/c1-11-24-20-17(21(33)25-11)26-23(28-27-15-8-6-5-7-9-15)29(20)22-19(36-14(4)32)18(35-13(3)31)16(37-22)10-34-12(2)30/h5-9,16,18-19,22H,10H2,1-4H3,(H,24,25,33)/b28-27+/t16-,18?,19+,22-/m1/s1 |
| InChIKey | VDAWQVQDVXXOKY-OSOCCNEGSA-N |
| XLogP | 2.17 |
| TPSA | 176.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|