C32H33N5O9 — CID 69019679
9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-8-methylpurine-2-carboxylic acid (PubChem CID 69019679) has the molecular formula C32H33N5O9 and a molecular weight of 631.64 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-8-methylpurine-2-carboxylic acid.
| Compound Name | 9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-8-methylpurine-2-carboxylic acid |
|---|---|
| PubChem CID | 69019679 |
| Molecular Formula | C32H33N5O9 |
| Molecular Weight | 631.64 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)-8-methylpurine-2-carboxylic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(C)nc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)O)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H33N5O9/c1-17-34-25-28(33-15-23(21-11-7-5-8-12-21)22-13-9-6-10-14-22)35-29(32(41)42)36-30(25)37(17)31-27(45-20(4)40)26(44-19(3)39)24(46-31)16-43-18(2)38/h5-14,23-24,26-27,31H,15-16H2,1-4H3,(H,41,42)(H,33,35,36)/t24-,26-,27-,31-/m1/s1 |
| InChIKey | UXPPIQLGAPADTF-YUGARCTCSA-N |
| XLogP | 3.40 |
| TPSA | 181.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|