C23H26N4O10 — CID 16664073
methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[(2-phenylacetyl)amino]-1,2,4-triazole-3-carboxylate (PubChem CID 16664073) has the molecular formula C23H26N4O10 and a molecular weight of 518.48 g/mol. Its IUPAC name is methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[(2-phenylacetyl)amino]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[(2-phenylacetyl)amino]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 16664073 |
| Molecular Formula | C23H26N4O10 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[(2-phenylacetyl)amino]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)Cc2ccccc2)n([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)n1 |
| InChI | InChI=1S/C23H26N4O10/c1-12(28)34-11-16-18(35-13(2)29)19(36-14(3)30)21(37-16)27-23(25-20(26-27)22(32)33-4)24-17(31)10-15-8-6-5-7-9-15/h5-9,16,18-19,21H,10-11H2,1-4H3,(H,24,25,26,31)/t16-,18-,19-,21-/m1/s1 |
| InChIKey | ZGJXUCGBPJAVSL-XLBJILASSA-N |
| XLogP | 0.57 |
| TPSA | 174.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|