C23H24ClN5O8 — CID 171471699
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-chloro-4-(phenylmethoxyamino)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 171471699) has the molecular formula C23H24ClN5O8 and a molecular weight of 533.93 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-chloro-4-(phenylmethoxyamino)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-chloro-4-(phenylmethoxyamino)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 171471699 |
| Molecular Formula | C23H24ClN5O8 |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-chloro-4-(phenylmethoxyamino)pyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ncc3c(NOCc4ccccc4)nc(Cl)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H24ClN5O8/c1-12(30)33-11-17-18(35-13(2)31)19(36-14(3)32)22(37-17)29-21-16(9-25-29)20(26-23(24)27-21)28-34-10-15-7-5-4-6-8-15/h4-9,17-19,22H,10-11H2,1-3H3,(H,26,27,28)/t17-,18-,19-,22-/m1/s1 |
| InChIKey | UGLKZRUHNKUFOH-JPAWQOSXSA-N |
| XLogP | 2.35 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|