C19H21N5O5 — CID 131885196
[(2R,3S,4R,5R)-5-[4-(benzylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 131885196) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-(benzylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-(benzylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 131885196 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-(benzylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21N5O5/c1-11(25)28-9-14-15(26)16(27)19(29-14)24-18-13(8-23-24)17(21-10-22-18)20-7-12-5-3-2-4-6-12/h2-6,8,10,14-16,19,26-27H,7,9H2,1H3,(H,20,21,22)/t14-,15-,16-,19-/m1/s1 |
| InChIKey | ROWUGBGBZJEZHT-YKTARERQSA-N |
| XLogP | 0.62 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |