C17H18FN5O4 — CID 22295151
(2R,3R,4S,5R)-2-[4-[(2-fluorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 22295151) has the molecular formula C17H18FN5O4 and a molecular weight of 375.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-[(2-fluorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-[(2-fluorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 22295151 |
| Molecular Formula | C17H18FN5O4 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-[(2-fluorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4F)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H18FN5O4/c18-11-4-2-1-3-9(11)5-19-15-10-6-22-23(16(10)21-8-20-15)17-14(26)13(25)12(7-24)27-17/h1-4,6,8,12-14,17,24-26H,5,7H2,(H,19,20,21)/t12-,13-,14-,17-/m1/s1 |
| InChIKey | KDNUEZWOZGLAIQ-VMUDFCTBSA-N |
| XLogP | 0.19 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |