C17H19N5O7 — CID 87135808
4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzene-1,2,3-triol (PubChem CID 87135808) has the molecular formula C17H19N5O7 and a molecular weight of 405.37 g/mol. Its IUPAC name is 4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 87135808 |
| Molecular Formula | C17H19N5O7 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]benzene-1,2,3-triol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(O)c(O)c4O)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19N5O7/c23-4-9-13(27)14(28)17(29-9)22-6-21-10-15(19-5-20-16(10)22)18-3-7-1-2-8(24)12(26)11(7)25/h1-2,5-6,9,13-14,17,23-28H,3-4H2,(H,18,19,20)/t9-,13-,14-,17-/m1/s1 |
| InChIKey | POCUTVZISBRSOG-KRQFVHPKSA-N |
| XLogP | -0.83 |
| TPSA | 186.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|