C17H18BrN5O5 — CID 66754865
(3R,4S,5R)-2-[6-[(5-bromo-2-hydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 66754865) has the molecular formula C17H18BrN5O5 and a molecular weight of 452.27 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-[(5-bromo-2-hydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-[(5-bromo-2-hydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 66754865 |
| Molecular Formula | C17H18BrN5O5 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | (3R,4S,5R)-2-[6-[(5-bromo-2-hydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1OC(n2cnc3c(NCc4cc(Br)ccc4O)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H18BrN5O5/c18-9-1-2-10(25)8(3-9)4-19-15-12-16(21-6-20-15)23(7-22-12)17-14(27)13(26)11(5-24)28-17/h1-3,6-7,11,13-14,17,24-27H,4-5H2,(H,19,20,21)/t11-,13-,14-,17?/m1/s1 |
| InChIKey | PQEHFYDHEMMJMP-IKYDMHQPSA-N |
| XLogP | 0.52 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|