C17H17F2N5O4 — CID 10046077
(2R,3R,4S,5R)-2-[6-[(2,4-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10046077) has the molecular formula C17H17F2N5O4 and a molecular weight of 393.35 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[(2,4-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[(2,4-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10046077 |
| Molecular Formula | C17H17F2N5O4 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[(2,4-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(F)cc4F)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H17F2N5O4/c18-9-2-1-8(10(19)3-9)4-20-15-12-16(22-6-21-15)24(7-23-12)17-14(27)13(26)11(5-25)28-17/h1-3,6-7,11,13-14,17,25-27H,4-5H2,(H,20,21,22)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | YMMKPOCQTLPIRC-LSCFUAHRSA-N |
| XLogP | 0.33 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |