C17H16ClF2N5O4 — CID 66754968
(2R,3R,4S,5R)-2-[6-[(2-chloro-3,6-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 66754968) has the molecular formula C17H16ClF2N5O4 and a molecular weight of 427.80 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[(2-chloro-3,6-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[(2-chloro-3,6-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 66754968 |
| Molecular Formula | C17H16ClF2N5O4 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[(2-chloro-3,6-difluorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCc4c(F)ccc(F)c4Cl)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H16ClF2N5O4/c18-11-7(8(19)1-2-9(11)20)3-21-15-12-16(23-5-22-15)25(6-24-12)17-14(28)13(27)10(4-26)29-17/h1-2,5-6,10,13-14,17,26-28H,3-4H2,(H,21,22,23)/t10-,13-,14-,17-/m1/s1 |
| InChIKey | OHTFPHJXSZUNIP-IWCJZZDYSA-N |
| XLogP | 0.98 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|