C17H18ClN5O6 — CID 66754543
(3R,4S,5R)-2-[6-[(5-chloro-2,3-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 66754543) has the molecular formula C17H18ClN5O6 and a molecular weight of 423.81 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-[(5-chloro-2,3-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-[(5-chloro-2,3-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 66754543 |
| Molecular Formula | C17H18ClN5O6 |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (3R,4S,5R)-2-[6-[(5-chloro-2,3-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1OC(n2cnc3c(NCc4cc(Cl)cc(O)c4O)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H18ClN5O6/c18-8-1-7(12(26)9(25)2-8)3-19-15-11-16(21-5-20-15)23(6-22-11)17-14(28)13(27)10(4-24)29-17/h1-2,5-6,10,13-14,17,24-28H,3-4H2,(H,19,20,21)/t10-,13-,14-,17?/m1/s1 |
| InChIKey | RIYZLKLIYQIKOU-NVONZOAYSA-N |
| XLogP | 0.11 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|