C17H19N5O6 — CID 121397952
(2R,3S,4S,5R)-2-[6-[(2,4-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 121397952) has the molecular formula C17H19N5O6 and a molecular weight of 389.37 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[6-[(2,4-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-[6-[(2,4-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 121397952 |
| Molecular Formula | C17H19N5O6 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (2R,3S,4S,5R)-2-[6-[(2,4-dihydroxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(O)cc4O)ncnc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19N5O6/c23-5-11-13(26)14(27)17(28-11)22-7-21-12-15(19-6-20-16(12)22)18-4-8-1-2-9(24)3-10(8)25/h1-3,6-7,11,13-14,17,23-27H,4-5H2,(H,18,19,20)/t11-,13-,14+,17-/m1/s1 |
| InChIKey | JQFPGPVUQCRXMX-MBMVNNNZSA-N |
| XLogP | -0.54 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|