C18H21N5O6 — CID 121399368
(3S,4S,5R)-2-[6-[(2-hydroxy-4-methoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 121399368) has the molecular formula C18H21N5O6 and a molecular weight of 403.40 g/mol. Its IUPAC name is (3S,4S,5R)-2-[6-[(2-hydroxy-4-methoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3S,4S,5R)-2-[6-[(2-hydroxy-4-methoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 121399368 |
| Molecular Formula | C18H21N5O6 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (3S,4S,5R)-2-[6-[(2-hydroxy-4-methoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1ccc(CNc2ncnc3c2ncn3C2O[C@H](CO)[C@@H](O)[C@@H]2O)c(O)c1 |
| InChI | InChI=1S/C18H21N5O6/c1-28-10-3-2-9(11(25)4-10)5-19-16-13-17(21-7-20-16)23(8-22-13)18-15(27)14(26)12(6-24)29-18/h2-4,7-8,12,14-15,18,24-27H,5-6H2,1H3,(H,19,20,21)/t12-,14-,15+,18?/m1/s1 |
| InChIKey | IOWAXZIJOUZMDE-ZMSWOTSGSA-N |
| XLogP | -0.24 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|